ChemNet > CAS > 20300-02-1 Thiophene-2-thiocarboxamide
20300-02-1 Thiophene-2-thiocarboxamide
název výrobku |
Thiophene-2-thiocarboxamide |
Anglický název |
Thiophene-2-thiocarboxamide; Thiophene-2-carbothioamide |
Molekulární vzorec |
C5H5NS2 |
Molekulová hmotnost |
143.2299 |
InChI |
InChI=1/C5H5NS2/c6-5(7)4-2-1-3-8-4/h1-3H,(H2,6,7) |
Registrační číslo CAS |
20300-02-1 |
Molekulární struktura |
|
Hustota |
1.357g/cm3 |
Bod tání |
106℃ |
Bod varu |
259.5°C at 760 mmHg |
Index lomu |
1.701 |
Bod vzplanutí |
110.7°C |
Tlak par |
0.0129mmHg at 25°C |
Symbolů nebezpečnosti |
Xi:Irritant;
|
Riziko Codes |
R25:Toxic if swallowed.;
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|