ChemNet > CAS > 2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
| název výrobku |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Anglický název |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate; 3-Acetyl-2,4-dimethyl-5-carbethoxypyrrole; 4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl propanoate |
| Molekulární vzorec |
C11H15NO3 |
| Molekulová hmotnost |
209.2417 |
| InChI |
InChI=1/C11H15NO3/c1-5-9(14)15-11-6(2)10(8(4)13)7(3)12-11/h12H,5H2,1-4H3 |
| Registrační číslo CAS |
2386-26-7 |
| Molekulární struktura |
|
| Hustota |
1.125g/cm3 |
| Bod tání |
139℃ |
| Bod varu |
348.9°C at 760 mmHg |
| Index lomu |
1.517 |
| Bod vzplanutí |
164.8°C |
| Tlak par |
4.89E-05mmHg at 25°C |
| Symbolů nebezpečnosti |
 Xi:Irritant;
|
| Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
