ChemNet > CAS > 23911-26-4 diethylenetriamine-pentaacetic acid dianhydride
23911-26-4 diethylenetriamine-pentaacetic acid dianhydride
název výrobku |
diethylenetriamine-pentaacetic acid dianhydride |
Anglický název |
diethylenetriamine-pentaacetic acid dianhydride; Diethylenetriaminepentaacetic acid dianhydride; DTPA Dianhydride; N,N-bis[2-(2,6-dioxomorpholin-4-yl)ethyl]glycine |
Molekulární vzorec |
C14H19N3O8 |
Molekulová hmotnost |
357.316 |
InChI |
InChI=1/C14H19N3O8/c18-10(19)5-15(1-3-16-6-11(20)24-12(21)7-16)2-4-17-8-13(22)25-14(23)9-17/h1-9H2,(H,18,19) |
Registrační číslo CAS |
23911-26-4 |
Molekulární struktura |
|
Hustota |
1.46g/cm3 |
Bod tání |
190-184℃ |
Bod varu |
656.2°C at 760 mmHg |
Index lomu |
1.558 |
Bod vzplanutí |
350.6°C |
Tlak par |
6.53E-19mmHg at 25°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|