ChemNet > CAS > 25038-71-5 poly(ethylen-ko-tetrafluorethylen)
25038-71-5 poly(ethylen-ko-tetrafluorethylen)
název výrobku |
poly(ethylen-ko-tetrafluorethylen) |
Synonyma |
Tefzel; ethen, 1,1,2,2-tetrafluor-, polymer s ethenem; Ethen, tetrafluor-, polymer s ethenem; eten - tetrafluorethan (1:1) |
Anglický název |
poly(ethylene-co-tetrafluoroethylene);Tefzel; Ethene, 1,1,2,2-tetrafluoro-, polymer with ethene; Ethene, tetrafluoro-, polymer with ethene; ethene - tetrafluoroethene (1:1) |
Molekulární vzorec |
C4H4F4 |
Molekulová hmotnost |
128.0682 |
InChI |
InChI=1/C2F4.C2H4/c3-1(4)2(5)6;1-2/h;1-2H2 |
Registrační číslo CAS |
25038-71-5 |
Molekulární struktura |
|
Tlak par |
20000mmHg at 25°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
|
Bezpečnostní Popis |
|
|