ChemNet > CAS > 26496-94-6 4-Bromobenzoic acid ethyl ester
26496-94-6 4-Bromobenzoic acid ethyl ester
| název výrobku |
4-Bromobenzoic acid ethyl ester |
| Anglický název |
4-Bromobenzoic acid ethyl ester; Ethyl 4-(bromomethyl)benzoate; 4-(Bromomethyl)benzoic acid ethyl ester~4-Ethoxycarbonylbenzyl bromide |
| Molekulární vzorec |
C10H11BrO2 |
| Molekulová hmotnost |
243.0971 |
| InChI |
InChI=1/C10H11BrO2/c1-2-13-10(12)9-5-3-8(7-11)4-6-9/h3-6H,2,7H2,1H3 |
| Registrační číslo CAS |
26496-94-6 |
| Molekulární struktura |
|
| Hustota |
1.402g/cm3 |
| Bod varu |
302.8°C at 760 mmHg |
| Index lomu |
1.551 |
| Bod vzplanutí |
136.9°C |
| Tlak par |
0.000967mmHg at 25°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R22:Harmful if swallowed.;
R34:Causes burns.;
R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
