ChemNet > CAS > 26782-74-1 (S)-2-chloro-3-methylbutyric acid
26782-74-1 (S)-2-chloro-3-methylbutyric acid
| název výrobku |
(S)-2-chloro-3-methylbutyric acid |
| Anglický název |
(S)-2-chloro-3-methylbutyric acid; (S)-(-)-2-Chloro-3-methylbutyric acid; S-2-chloro-3-methylbutyric acid; (2S)-2-chloro-3-methylbutanoic acid |
| Molekulární vzorec |
C5H9ClO2 |
| Molekulová hmotnost |
136.5768 |
| InChI |
InChI=1/C5H9ClO2/c1-3(2)4(6)5(7)8/h3-4H,1-2H3,(H,7,8)/t4-/m0/s1 |
| Registrační číslo CAS |
26782-74-1 |
| Molekulární struktura |
|
| Hustota |
1.159g/cm3 |
| Bod varu |
210.3°C at 760 mmHg |
| Index lomu |
1.447 |
| Bod vzplanutí |
81°C |
| Tlak par |
0.0768mmHg at 25°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R34:Causes burns.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
