ChemNet > CAS > 28446-68-6 4-Methoxycinnamonitrile, mixture of cis- and trans isomers
28446-68-6 4-Methoxycinnamonitrile, mixture of cis- and trans isomers
| název výrobku |
4-Methoxycinnamonitrile, mixture of cis- and trans isomers |
| Anglický název |
4-Methoxycinnamonitrile, mixture of cis- and trans isomers; 4-Methoxycinnamonitrile; 3-(4-methoxyphenyl)prop-2-enenitrile; (2E)-3-(4-methoxyphenyl)prop-2-enenitrile |
| Molekulární vzorec |
C10H9NO |
| Molekulová hmotnost |
159.1846 |
| InChI |
InChI=1/C10H9NO/c1-12-10-6-4-9(5-7-10)3-2-8-11/h2-7H,1H3/b3-2+ |
| Registrační číslo CAS |
28446-68-6 |
| EINECS |
249-022-4 |
| Molekulární struktura |
|
| Hustota |
1.077g/cm3 |
| Bod varu |
327.8°C at 760 mmHg |
| Index lomu |
1.573 |
| Bod vzplanutí |
131.6°C |
| Tlak par |
0.000197mmHg at 25°C |
| Symbolů nebezpečnosti |
 Xn:Harmful;
|
| Riziko Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Bezpečnostní Popis |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
