ChemNet > CAS > 3048-64-4 5-Vinyl-2-norbornene
3048-64-4 5-Vinyl-2-norbornene
| název výrobku |
5-Vinyl-2-norbornene |
| Anglický název |
5-Vinyl-2-norbornene; 5-Vinyl-2-norbornene,mixture of endo and exo; Vinylnorbornene; 2-ethenylbicyclo[2.2.1]hept-1-ene; 5-ethenylbicyclo[2.2.1]hept-1-ene |
| Molekulová hmotnost |
C9H8 |
| InChI |
InChI=1/C9H12/c1-2-8-5-7-3-4-9(8)6-7/h2-3,8-9H,1,4-6H2 |
| Registrační číslo CAS |
3048-64-4 |
| EINECS |
221-259-8 |
| Molekulární struktura |
|
| Hustota |
1.612 |
| Bod tání |
-80℃ |
| Bod varu |
137.909°C |
| Index lomu |
144.1732 |
| Bod vzplanutí |
1.189g/cm3 |
| Tlak par |
304 |
| Symbolů nebezpečnosti |
 Xn:Harmful;
|
| Riziko Codes |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/38:Irritating to eyes and skin.;
|
| Bezpečnostní Popis |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
