ChemNet > CAS > 3066-71-5 Cyclohexyl acrylate
3066-71-5 Cyclohexyl acrylate
| název výrobku |
Cyclohexyl acrylate |
| Anglický název |
Cyclohexyl acrylate; Cyclohexyl acrylate,(Acrylic acid cyclohexyl ester); Acrylic acid cyclohexyl ester; cyclohexyl prop-2-enoate; 2-cyclohexylprop-2-enoate |
| Molekulární vzorec |
C9H13O2 |
| Molekulová hmotnost |
153.1989 |
| InChI |
InChI=1/C9H14O2/c1-7(9(10)11)8-5-3-2-4-6-8/h8H,1-6H2,(H,10,11)/p-1 |
| Registrační číslo CAS |
3066-71-5 |
| EINECS |
221-319-3 |
| Molekulární struktura |
|
| Bod varu |
283.7°C at 760 mmHg |
| Bod vzplanutí |
189.9°C |
| Tlak par |
0.000811mmHg at 25°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R37/38:Irritating to respiratory system and skin.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Bezpečnostní Popis |
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
