ChemNet > CAS > 3147-39-5 Methyl 2,4,6-trihydroxybenzoate
3147-39-5 Methyl 2,4,6-trihydroxybenzoate
název výrobku |
Methyl 2,4,6-trihydroxybenzoate |
Anglický název |
Methyl 2,4,6-trihydroxybenzoate; 2,4,6-Trihydroxybenzoic acid methyl ester; Phloroglucinolcarboxylic acid methyl ester |
Molekulární vzorec |
C8H8O5 |
Molekulová hmotnost |
184.1461 |
InChI |
InChI=1/C8H8O5/c1-13-8(12)7-5(10)2-4(9)3-6(7)11/h2-3,9-11H,1H3 |
Registrační číslo CAS |
3147-39-5 |
EINECS |
221-566-7 |
Molekulární struktura |
|
Hustota |
1.501g/cm3 |
Bod tání |
174-176℃ |
Bod varu |
359.5°C at 760 mmHg |
Index lomu |
1.63 |
Bod vzplanutí |
150.3°C |
Tlak par |
1.14E-05mmHg at 25°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|