ChemNet > CAS > 41927-01-9 3,4-Dimethyl-o-phenylenediamine
41927-01-9 3,4-Dimethyl-o-phenylenediamine
název výrobku |
3,4-Dimethyl-o-phenylenediamine |
Anglický název |
3,4-Dimethyl-o-phenylenediamine; 3,4-Diamino-o-xylene = 3,4-Dimethylphenylenediamine; 3,4-dimethylbenzene-1,2-diamine |
Molekulární vzorec |
C8H12N2 |
Molekulová hmotnost |
136.1943 |
InChI |
InChI=1/C8H12N2/c1-5-3-4-7(9)8(10)6(5)2/h3-4H,9-10H2,1-2H3 |
Registrační číslo CAS |
41927-01-9 |
Molekulární struktura |
|
Hustota |
1.076g/cm3 |
Bod varu |
278.3°C at 760 mmHg |
Index lomu |
1.618 |
Bod vzplanutí |
143.9°C |
Tlak par |
0.00431mmHg at 25°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|