ChemNet > CAS > 42225-04-7 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile
42225-04-7 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile
| název výrobku |
2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| Anglický název |
2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile;(6S)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile; (6R)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| Molekulární vzorec |
C10H12N2S |
| Molekulová hmotnost |
192.2807 |
| InChI |
InChI=1/C10H12N2S/c1-6-2-3-7-8(5-11)10(12)13-9(7)4-6/h6H,2-4,12H2,1H3/t6-/m1/s1 |
| Registrační číslo CAS |
42225-04-7 |
| Molekulární struktura |
|
| Hustota |
1.22g/cm3 |
| Bod tání |
147℃ |
| Bod varu |
392.8°C at 760 mmHg |
| Index lomu |
1.607 |
| Bod vzplanutí |
191.4°C |
| Tlak par |
2.23E-06mmHg at 25°C |
| Symbolů nebezpečnosti |
 Xn:Harmful;
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|
