ChemNet > CAS > 5117-88-4 2-amino-4,5-dimethyl-3-furankarbonitril
5117-88-4 2-amino-4,5-dimethyl-3-furankarbonitril
| název výrobku |
2-amino-4,5-dimethyl-3-furankarbonitril |
| Synonyma |
2-amino-4,5-dimethyl-3-furonitril; 2-amino-4,5-dimethylfuran-3-karbonitril |
| Anglický název |
2-amino-4,5-dimethyl-3-furancarbonitrile; 2-Amino-4,5-dimethyl-3-furonitrile; 2-amino-4,5-dimethylfuran-3-carbonitrile |
| Molekulární vzorec |
C7H8N2O |
| Molekulová hmotnost |
136.1512 |
| InChI |
InChI=1/C7H8N2O/c1-4-5(2)10-7(9)6(4)3-8/h9H2,1-2H3 |
| Registrační číslo CAS |
5117-88-4 |
| Molekulární struktura |
|
| Hustota |
1.15g/cm3 |
| Bod tání |
163-169℃ |
| Bod varu |
287.8°C at 760 mmHg |
| Index lomu |
1.535 |
| Bod vzplanutí |
127.8°C |
| Tlak par |
0.00244mmHg at 25°C |
| Symbolů nebezpečnosti |
Xn:Harmful;
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpečnostní Popis |
S36/37:Wear suitable protective clothing and gloves.;
|
|