5144-10-5 Pentamethylbenzonitrile
název výrobku |
Pentamethylbenzonitrile |
Anglický název |
Pentamethylbenzonitrile; Penthamethylbenzonitrile |
Molekulární vzorec |
C12H15N |
Molekulová hmotnost |
173.2542 |
InChI |
InChI=1/C12H15N/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h1-5H3 |
Registrační číslo CAS |
5144-10-5 |
EINECS |
225-912-8 |
Molekulární struktura |
|
Hustota |
0.96g/cm3 |
Bod tání |
158-160℃ |
Bod varu |
313.2°C at 760 mmHg |
Index lomu |
1.515 |
Bod vzplanutí |
143.8°C |
Tlak par |
0.000503mmHg at 25°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R20/22:Harmful by inhalation and if swallowed.;
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|