ChemNet > CAS > 526-73-8 1,2,3-Trimethylbenzene
526-73-8 1,2,3-Trimethylbenzene
| název výrobku |
1,2,3-Trimethylbenzene |
| Anglický název |
1,2,3-Trimethylbenzene; hemimellitene |
| Molekulární vzorec |
C9H12 |
| Molekulová hmotnost |
120.19 |
| InChI |
InChI=1/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3 |
| Registrační číslo CAS |
526-73-8 |
| EINECS |
208-394-8 |
| Molekulární struktura |
|
| Hustota |
0.894 |
| Bod tání |
-25℃ |
| Bod varu |
175-176℃ |
| Index lomu |
1.513 |
| Bod vzplanutí |
53℃ |
| Symbolů nebezpečnosti |
 Xi:Irritant;
|
| Riziko Codes |
R10:;
R37:;
|
| Bezpečnostní Popis |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
