ChemNet > CAS > 556-48-9 1,4-Cyclohexanediol, mixture of cis and trans
556-48-9 1,4-Cyclohexanediol, mixture of cis and trans
| název výrobku |
1,4-Cyclohexanediol, mixture of cis and trans |
| Anglický název |
1,4-Cyclohexanediol, mixture of cis and trans; Cyclohexanediolcistrans; 1,4-Cyclohexanediol; Hexahydrohydroquinone; 1,4-Hexandiol; Quinitol; 1,4-Bis(hydroxymethyl)-cyclohexane; cyclohexane-1,4-diol; trans-cyclohexane-1,4-diol; 1,4-Cyclohexanediol (cis & trans mixture) |
| Molekulární vzorec |
C6H12O2 |
| Molekulová hmotnost |
116.1583 |
| InChI |
InChI=1/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2/t5-,6- |
| Registrační číslo CAS |
556-48-9 |
| EINECS |
209-126-2 |
| Molekulární struktura |
|
| Hustota |
1.156g/cm3 |
| Bod tání |
98-100℃ |
| Bod varu |
252.4°C at 760 mmHg |
| Index lomu |
1.526 |
| Bod vzplanutí |
65.6°C |
| Tlak par |
0.00301mmHg at 25°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
|
| Bezpečnostní Popis |
S24/25:;
|
|
