ChemNet > CAS > 56309-62-7 2,5-dimethoxyphenyl isocyanate
56309-62-7 2,5-dimethoxyphenyl isocyanate
| název výrobku |
2,5-dimethoxyphenyl isocyanate |
| Anglický název |
2,5-dimethoxyphenyl isocyanate;2-isocyanato-1,4-dimethoxybenzene |
| Molekulární vzorec |
C9H9NO3 |
| Molekulová hmotnost |
179.1727 |
| InChI |
InChI=1/C9H9NO3/c1-12-7-3-4-9(13-2)8(5-7)10-6-11/h3-5H,1-2H3 |
| Registrační číslo CAS |
56309-62-7 |
| Molekulární struktura |
|
| Hustota |
1.1g/cm3 |
| Bod tání |
40-42℃ |
| Bod varu |
279.5°C at 760 mmHg |
| Index lomu |
1.501 |
| Bod vzplanutí |
131.6°C |
| Tlak par |
0.004mmHg at 25°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| Bezpečnostní Popis |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
