ChemNet > CAS > 583-57-3 1,2-Dimethylcyclohexane
583-57-3 1,2-Dimethylcyclohexane
| název výrobku |
1,2-Dimethylcyclohexane |
| Anglický název |
1,2-Dimethylcyclohexane; 1,2-Dimethylcyclohexane (cis+trans); (1R,2R)-1,2-dimethylcyclohexane |
| Molekulární vzorec |
C8H16 |
| Molekulová hmotnost |
112.2126 |
| InChI |
InChI=1/C8H16/c1-7-5-3-4-6-8(7)2/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| Registrační číslo CAS |
583-57-3 |
| EINECS |
209-509-4 |
| Molekulární struktura |
|
| Hustota |
0.766g/cm3 |
| Bod varu |
125.9°C at 760 mmHg |
| Index lomu |
1.42 |
| Bod vzplanutí |
15.6°C |
| Tlak par |
14.5mmHg at 25°C |
| Symbolů nebezpečnosti |
 F:Highly flammable;
|
| Riziko Codes |
R11:Highly flammable.;
R38:Irritating to skin.;
|
| Bezpečnostní Popis |
S16:Keep away from sources of ignition - No smoking.;
S33:Take precautionary measures against static discharges.;
S37:Wear suitable gloves.;
S9:Keep container in a well-ventilated place.;
|
|
