ChemNet > CAS > 6296-99-7 Diethyl aminomethylenemalonate
6296-99-7 Diethyl aminomethylenemalonate
| název výrobku |
Diethyl aminomethylenemalonate |
| Anglický název |
Diethyl aminomethylenemalonate; Aminomethylenemalonic acid diethyl ester; Diethyl(aminomethylene)malonate; diethyl (aminomethylidene)propanedioate; Diethyl 2-(aminomethylene)malonate |
| Molekulární vzorec |
C8H13NO4 |
| Molekulová hmotnost |
187.1931 |
| InChI |
InChI=1/C8H13NO4/c1-3-12-7(10)6(5-9)8(11)13-4-2/h5H,3-4,9H2,1-2H3 |
| Registrační číslo CAS |
6296-99-7 |
| Molekulární struktura |
|
| Hustota |
1.136g/cm3 |
| Bod varu |
263.4°C at 760 mmHg |
| Index lomu |
1.471 |
| Bod vzplanutí |
105.3°C |
| Tlak par |
0.0103mmHg at 25°C |
| Riziko Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R43:May cause sensitization by skin contact.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|