ChemNet > CAS > 66085-00-5 kyselina isooktadekanová, monoester s glycerolem
66085-00-5 kyselina isooktadekanová, monoester s glycerolem
| název výrobku |
kyselina isooktadekanová, monoester s glycerolem |
| Synonyma |
Glyceryl isostearát; glyceryl monoisostearát; Isooktadekanová kyselina, monoester s 1,2,3-propantriolem; Glycerol monoisostearát; kyselina isostearová, ester 1,2,3-propanderiolu (1:1); Isooktadekanová kyselina, monoester s glycerolem; 2-hydroxy-1-(hydroxymethyl)ethyl-16-methylheptadekanoát |
| Anglický název |
isooctadecanoic acid, monoester with glycerol; Glyceryl isostearate; Glyceryl monoisostearate; Isooctadecanoic acid, monoester with 1,2,3-propanetriol; Glycerol monoisostearate; Isostearic acid, 1,2,3-propaneriol ester (1:1); Isooctadecanoic acid, monoester with glycerol; 2-hydroxy-1-(hydroxymethyl)ethyl 16-methylheptadecanoate; Glyceryl lsostearate |
| Molekulární vzorec |
C21H42O4 |
| Molekulová hmotnost |
358.5558 |
| InChI |
InChI=1/C21H42O4/c1-19(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-21(24)25-20(17-22)18-23/h19-20,22-23H,3-18H2,1-2H3 |
| Registrační číslo CAS |
66085-00-5 |
| EINECS |
266-124-4 |
| Molekulární struktura |
|
| Hustota |
0.957g/cm3 |
| Bod varu |
481.5°C at 760 mmHg |
| Index lomu |
1.468 |
| Bod vzplanutí |
153.8°C |
| Tlak par |
2.7E-11mmHg at 25°C |
|