ChemNet > CAS > 66424-91-7 5-Methyl-2-nitrobenzyl chloride
66424-91-7 5-Methyl-2-nitrobenzyl chloride
název výrobku |
5-Methyl-2-nitrobenzyl chloride |
Anglický název |
5-Methyl-2-nitrobenzyl chloride; alpha-chloro-5-methyl-2-nitrotoluene; 2-(chloromethyl)-4-methyl-1-nitrobenzene |
Molekulární vzorec |
C8H8ClNO2 |
Molekulová hmotnost |
185.6076 |
InChI |
InChI=1/C8H8ClNO2/c1-6-2-3-8(10(11)12)7(4-6)5-9/h2-4H,5H2,1H3 |
Registrační číslo CAS |
66424-91-7 |
EINECS |
266-359-2 |
Molekulární struktura |
|
Hustota |
1.277g/cm3 |
Bod tání |
41-43℃ |
Bod varu |
292.3°C at 760 mmHg |
Index lomu |
1.566 |
Bod vzplanutí |
130.6°C |
Tlak par |
0.00324mmHg at 25°C |
Symbolů nebezpečnosti |
C:Corrosive;
|
Riziko Codes |
R34:Causes burns.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|