ChemNet > CAS > 69604-00-8 Ethyl 5-nitrobenzofuran-2-carboxylate
69604-00-8 Ethyl 5-nitrobenzofuran-2-carboxylate
název výrobku |
Ethyl 5-nitrobenzofuran-2-carboxylate |
Anglický název |
Ethyl 5-nitrobenzofuran-2-carboxylate; 5-Nitrobenzo[b]furan-2-carboxylic acid ethyl ester; 5-nitro-benzofuran-2-carboxylic acid ethyl ester; Vilazodone Intermediate 7; Ethyl 5-nitrobenzo[b]furan-2-carboxylate |
Molekulární vzorec |
C11H9NO5 |
Molekulová hmotnost |
235.1929 |
InChI |
InChI=1/C11H9NO5/c1-2-16-11(13)10-6-7-5-8(12(14)15)3-4-9(7)17-10/h3-6H,2H2,1H3 |
Registrační číslo CAS |
69604-00-8 |
Molekulární struktura |
|
Hustota |
1.362g/cm3 |
Bod tání |
150℃ |
Bod varu |
359.7°C at 760 mmHg |
Index lomu |
1.603 |
Bod vzplanutí |
171.3°C |
Tlak par |
2.34E-05mmHg at 25°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
|
Bezpečnostní Popis |
S24/25:Avoid contact with skin and eyes.;
|
|