ChemNet > CAS > 72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
název výrobku |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
Anglický název |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
Molekulární vzorec |
C14H8Cl4 |
Molekulová hmotnost |
318.02 |
InChI |
InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
Registrační číslo CAS |
72-55-9 |
EINECS |
200-784-6 |
Molekulární struktura |
|
Bod tání |
87-90℃ |
Rozpustnost ve vodě |
0.00000013 g/100 mL |
Symbolů nebezpečnosti |
Xn:Harmful;
|
Riziko Codes |
R22:Harmful if swallowed.;
R33:Danger of cummulative effects.;
|
Bezpečnostní Popis |
S24/25:Avoid contact with skin and eyes.;
|
|