76058-33-8 Ethyl Red
název výrobku |
Ethyl Red |
Anglický název |
Ethyl Red; 2-[4-(Diethylamino)phenylazo]benzoic acid; 2-(4-Diethylaminophenylazo)benzoic acid; Diethyl red; 2-{(E)-[4-(diethylamino)phenyl]diazenyl}benzoate |
Molekulární vzorec |
C17H18N3O2 |
Molekulová hmotnost |
296.3443 |
InChI |
InChI=1/C17H19N3O2/c1-3-20(4-2)14-11-9-13(10-12-14)18-19-16-8-6-5-7-15(16)17(21)22/h5-12H,3-4H2,1-2H3,(H,21,22)/p-1/b19-18+ |
Registrační číslo CAS |
76058-33-8 |
Molekulární struktura |
|
Bod tání |
135℃ |
Bod varu |
496.9°C at 760 mmHg |
Bod vzplanutí |
254.3°C |
Tlak par |
1.09E-10mmHg at 25°C |
Symbolů nebezpečnosti |
Xn:Harmful;
|
Riziko Codes |
R20/21:Harmful by inhalation and in contact with skin.;
R32:Contact with acids liberates very toxic gas.;
|
Bezpečnostní Popis |
|
|