ChemNet > CAS > 771-62-0 pentafluorothiophenol
771-62-0 pentafluorothiophenol
| název výrobku |
pentafluorothiophenol |
| Anglický název |
pentafluorothiophenol; Pentafluorobenzenethiol |
| Molekulární vzorec |
C6HF5S |
| Molekulová hmotnost |
200.12 |
| InChI |
InChI=1/C6HF5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| Registrační číslo CAS |
771-62-0 |
| EINECS |
212-236-3 |
| Molekulární struktura |
|
| Hustota |
1.5 |
| Bod tání |
-24℃ |
| Bod varu |
143℃ |
| Index lomu |
1.463-1.465 |
| Bod vzplanutí |
51℃ |
| Symbolů nebezpečnosti |
 C:Corrosive;
|
| Riziko Codes |
R10:Flammable.;
R34:Causes burns.;
|
| Bezpečnostní Popis |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
