771-62-0 pentafluorothiophenol
název výrobku |
pentafluorothiophenol |
Anglický název |
pentafluorothiophenol; Pentafluorobenzenethiol |
Molekulární vzorec |
C6HF5S |
Molekulová hmotnost |
200.12 |
InChI |
InChI=1/C6HF5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
Registrační číslo CAS |
771-62-0 |
EINECS |
212-236-3 |
Molekulární struktura |
|
Hustota |
1.5 |
Bod tání |
-24℃ |
Bod varu |
143℃ |
Index lomu |
1.463-1.465 |
Bod vzplanutí |
51℃ |
Symbolů nebezpečnosti |
C:Corrosive;
|
Riziko Codes |
R10:Flammable.;
R34:Causes burns.;
|
Bezpečnostní Popis |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|