ChemNet > CAS > 79757-77-0 (4-bromo-2-thienyl)methanol
79757-77-0 (4-bromo-2-thienyl)methanol
| název výrobku |
(4-bromo-2-thienyl)methanol |
| Anglický název |
(4-bromo-2-thienyl)methanol; (4-bromothiophen-2-yl)methanol; (4-Bromothien-2-yl)methanol |
| Molekulární vzorec |
C5H5BrOS |
| Molekulová hmotnost |
193.0616 |
| InChI |
InChI=1/C5H5BrOS/c6-4-1-5(2-7)8-3-4/h1,3,7H,2H2 |
| Registrační číslo CAS |
79757-77-0 |
| Molekulární struktura |
|
| Hustota |
1.773g/cm3 |
| Bod varu |
271.491°C at 760 mmHg |
| Index lomu |
1.631 |
| Bod vzplanutí |
117.994°C |
| Tlak par |
0.003mmHg at 25°C |
| Symbolů nebezpečnosti |
 Xn:Harmful;
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
