ChemNet > CAS > 81452-54-2 Methyl 3-methylthiophene-2-carboxylate
81452-54-2 Methyl 3-methylthiophene-2-carboxylate
| název výrobku |
Methyl 3-methylthiophene-2-carboxylate |
| Anglický název |
Methyl 3-methylthiophene-2-carboxylate; 3-Methylthiophene-2-carboxylic acid methyl ester; Methyl-3-methylthiophene-2-carboxylate |
| Molekulární vzorec |
C7H8O2S |
| Molekulová hmotnost |
156.2022 |
| InChI |
InChI=1/C7H8O2S/c1-5-3-4-10-6(5)7(8)9-2/h3-4H,1-2H3 |
| Registrační číslo CAS |
81452-54-2 |
| Molekulární struktura |
|
| Hustota |
1.173g/cm3 |
| Bod varu |
211°C at 760 mmHg |
| Index lomu |
1.531 |
| Bod vzplanutí |
81.4°C |
| Tlak par |
0.186mmHg at 25°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
|
| Bezpečnostní Popis |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
