ChemNet > CAS > 91591-63-8 2,5-dichloro-4,6-dimethylnicotinonitrile
91591-63-8 2,5-dichloro-4,6-dimethylnicotinonitrile
| název výrobku |
2,5-dichloro-4,6-dimethylnicotinonitrile |
| Anglický název |
2,5-dichloro-4,6-dimethylnicotinonitrile;2,5-dichloro-4,6-dimethylpyridine-3-carbonitrile |
| Molekulární vzorec |
C8H6Cl2N2 |
| Molekulová hmotnost |
201.0526 |
| InChI |
InChI=1/C8H6Cl2N2/c1-4-6(3-11)8(10)12-5(2)7(4)9/h1-2H3 |
| Registrační číslo CAS |
91591-63-8 |
| Molekulární struktura |
|
| Hustota |
1.36g/cm3 |
| Bod tání |
78℃ |
| Bod varu |
304.6°C at 760 mmHg |
| Index lomu |
1.564 |
| Bod vzplanutí |
138°C |
| Tlak par |
0.000867mmHg at 25°C |
| Symbolů nebezpečnosti |
 Xn:Harmful;
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
