ChemNet > CAS > 94-32-6 ethyl 4-(butylamino)benzoate
94-32-6 ethyl 4-(butylamino)benzoate
název výrobku |
ethyl 4-(butylamino)benzoate |
Anglický název |
ethyl 4-(butylamino)benzoate; Ethyl 4-(n-butylamino)benzoate; 4-(n-Butylamino)benzoic acid ethyl ester; Ethyl-4-n-butylamino-benzoate |
Molekulární vzorec |
C13H19NO2 |
Molekulová hmotnost |
221.2955 |
InChI |
InChI=1/C13H19NO2/c1-3-5-10-14-12-8-6-11(7-9-12)13(15)16-4-2/h6-9,14H,3-5,10H2,1-2H3 |
Registrační číslo CAS |
94-32-6 |
EINECS |
202-322-9 |
Molekulární struktura |
|
Hustota |
1.039g/cm3 |
Bod tání |
68-70℃ |
Bod varu |
338.4°C at 760 mmHg |
Index lomu |
1.534 |
Bod vzplanutí |
158.4°C |
Tlak par |
9.87E-05mmHg at 25°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
|
Bezpečnostní Popis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|