ChemNet > CAS > 96994-73-9 2-dimethylamino-6-fluorobenzonitrile
96994-73-9 2-dimethylamino-6-fluorobenzonitrile
| název výrobku |
2-dimethylamino-6-fluorobenzonitrile |
| Anglický název |
2-dimethylamino-6-fluorobenzonitrile; |
| Molekulární vzorec |
C9H9FN2 |
| Molekulová hmotnost |
164.1796 |
| InChI |
InChI=1/C9H9FN2/c1-12(2)9-5-3-4-8(10)7(9)6-11/h3-5H,1-2H3 |
| Registrační číslo CAS |
96994-73-9 |
| Molekulární struktura |
|
| Hustota |
1.13g/cm3 |
| Bod varu |
267.4°C at 760 mmHg |
| Index lomu |
1.53 |
| Bod vzplanutí |
115.5°C |
| Tlak par |
0.00816mmHg at 25°C |
| Symbolů nebezpečnosti |
 Xn:Harmful;
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
