10047-28-6 butyl thioglycolate
Produkt-Name |
butyl thioglycolate |
Englischer Name |
butyl thioglycolate; |
Molekulare Formel |
C6H12O2S |
Molecular Weight |
148.2233 |
InChI |
InChI=1/C6H12O2S/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
CAS Registry Number |
10047-28-6 |
EINECS |
233-156-5 |
Molecular Structure |
|
Dichte |
1.088g/cm3 |
Siedepunkt |
220.125°C at 760 mmHg |
Brechungsindex |
1.491 |
Flammpunkt |
86.929°C |
Dampfdruck |
0.024mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|