ChemNet > CAS > 10079-53-5;5344-78-5 4-bromo-3-nitroanisole
10079-53-5;5344-78-5 4-bromo-3-nitroanisole
| Produkt-Name |
4-bromo-3-nitroanisole |
| Englischer Name |
4-bromo-3-nitroanisole; 4-BROMO-3-NITROTHIOANISOLE; TIMTEC-BB SBB009974; 1-bromo-4-methoxy-2-nitrobenzene |
| Molekulare Formel |
C7H6BrNO3 |
| Molecular Weight |
232.0314 |
| InChI |
InChI=1/C7H6BrNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| CAS Registry Number |
10079-53-5;5344-78-5 |
| EINECS |
226-290-0 |
| Molecular Structure |
|
| Dichte |
1.64g/cm3 |
| Schmelzpunkt |
32-34℃ |
| Siedepunkt |
291°C at 760 mmHg |
| Brechungsindex |
1.581 |
| Flammpunkt |
123°C |
| Dampfdruck |
0.00349mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
