ChemNet > CAS > 100859-84-5 2-Chloro isonicotinamide
100859-84-5 2-Chloro isonicotinamide
| Produkt-Name |
2-Chloro isonicotinamide |
| Englischer Name |
2-Chloro isonicotinamide;6-methyl-5-nitropyridin-2(1H)-one; 2-chloropyridine-4-carboxamide |
| Molekulare Formel |
C6H5ClN2O |
| Molecular Weight |
156.5697 |
| InChI |
InChI=1/C6H5ClN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
| CAS Registry Number |
100859-84-5 |
| Molecular Structure |
|
| Dichte |
1.381g/cm3 |
| Schmelzpunkt |
193℃ |
| Siedepunkt |
312.2°C at 760 mmHg |
| Brechungsindex |
1.588 |
| Flammpunkt |
142.6°C |
| Dampfdruck |
0.000535mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
