ChemNet > CAS > 1015-89-0 6(5H)-phenanthridinone
1015-89-0 6(5H)-phenanthridinone
| Produkt-Name |
6(5H)-phenanthridinone |
| Englischer Name |
6(5H)-phenanthridinone; Phenanthridinone; phenanthridin-6(5H)-one; 6(5H)-Phenanthridone; phenantridine-6(5H)-one |
| Molekulare Formel |
C13H9NO |
| Molecular Weight |
195.2167 |
| InChI |
InChI=1/C13H9NO/c15-13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)14-13/h1-8H,(H,14,15) |
| CAS Registry Number |
1015-89-0 |
| EINECS |
213-804-3 |
| Molecular Structure |
|
| Dichte |
1.231g/cm3 |
| Schmelzpunkt |
290-292℃ |
| Siedepunkt |
274.843°C at 760 mmHg |
| Brechungsindex |
1.642 |
| Flammpunkt |
158.663°C |
| Dampfdruck |
0.005mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
