10203-32-4 4-Dodecanol
Produkt-Name |
4-Dodecanol |
Englischer Name |
4-Dodecanol; n-Octyl-n-propyl carbinol; dodecan-4-ol |
Molekulare Formel |
C12H26O |
Molecular Weight |
186.3342 |
InChI |
InChI=1/C12H26O/c1-3-5-6-7-8-9-11-12(13)10-4-2/h12-13H,3-11H2,1-2H3 |
CAS Registry Number |
10203-32-4 |
EINECS |
233-502-5 |
Molecular Structure |
|
Dichte |
0.829g/cm3 |
Siedepunkt |
245.5°C at 760 mmHg |
Brechungsindex |
1.439 |
Flammpunkt |
100.1°C |
Dampfdruck |
0.00476mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|