| Produkt-Name |
Phytol |
| Englischer Name |
Phytol; phytol, mixture of isomers; (2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-ol; (2E)-3,7,11,15-tetramethylhexadec-2-en-1-ol; (2E,7R,11S)-3,7,11,15-tetramethylhexadec-2-en-1-ol; Natural Phytol |
| Molekulare Formel |
C20H40O |
| Molecular Weight |
296.531 |
| InChI |
InChI=1/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+/t18-,19+/m0/s1 |
| CAS Registry Number |
150-86-7;102608-53-7 |
| EINECS |
205-776-6 |
| Molecular Structure |
|
| Dichte |
0.845g/cm3 |
| Siedepunkt |
335.486°C at 760 mmHg |
| Brechungsindex |
1.46 |
| Flammpunkt |
157.526°C |
| Dampfdruck |
0mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
