ChemNet > CAS > 103-19-5 p-Tolyl disulfide
103-19-5 p-Tolyl disulfide
| Produkt-Name |
p-Tolyl disulfide |
| Englischer Name |
p-Tolyl disulfide; |
| Molekulare Formel |
C14H14S2 |
| Molecular Weight |
246.391 |
| InChI |
InChI=1/C14H14S2/c1-11-3-7-13(8-4-11)15-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| CAS Registry Number |
103-19-5 |
| EINECS |
203-087-5 |
| Molecular Structure |
|
| Dichte |
1.17g/cm3 |
| Schmelzpunkt |
43-46℃ |
| Siedepunkt |
349.5°C at 760 mmHg |
| Brechungsindex |
1.649 |
| Flammpunkt |
192.6°C |
| Dampfdruck |
9.46E-05mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
