ChemNet > CAS > 10315-03-4 4-Acetyl-4-phenylpiperidine hydrochloride
10315-03-4 4-Acetyl-4-phenylpiperidine hydrochloride
| Produkt-Name |
4-Acetyl-4-phenylpiperidine hydrochloride |
| Englischer Name |
4-Acetyl-4-phenylpiperidine hydrochloride; |
| Molekulare Formel |
C13H18NO |
| Molecular Weight |
204.2876 |
| InChI |
InChI=1/C13H17NO/c1-11(15)13(7-9-14-10-8-13)12-5-3-2-4-6-12/h2-6,14H,7-10H2,1H3/p+1 |
| CAS Registry Number |
10315-03-4 |
| EINECS |
233-694-0 |
| Molecular Structure |
|
| Schmelzpunkt |
232-234℃ |
| Siedepunkt |
325.2°C at 760 mmHg |
| Flammpunkt |
125.7°C |
| Dampfdruck |
0.000234mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
