ChemNet > CAS > 10328-92-4 N-Methylisatoic anhydride
10328-92-4 N-Methylisatoic anhydride
| Produkt-Name |
N-Methylisatoic anhydride |
| Englischer Name |
N-Methylisatoic anhydride; MIA; N-Methylisatoic Anhydride; 1-methyl-2H-3,1-benzoxazine-2,4(1H)-dione |
| Molekulare Formel |
C9H7NO3 |
| Molecular Weight |
177.1568 |
| InChI |
InChI=1/C9H7NO3/c1-10-7-5-3-2-4-6(7)8(11)13-9(10)12/h2-5H,1H3 |
| CAS Registry Number |
10328-92-4 |
| EINECS |
233-714-8 |
| Molecular Structure |
|
| Dichte |
1.348g/cm3 |
| Schmelzpunkt |
165℃ |
| Siedepunkt |
297.5°C at 760 mmHg |
| Brechungsindex |
1.583 |
| Flammpunkt |
133.7°C |
| Dampfdruck |
0.00135mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
