104-66-5 1,2-Diphenoxyethane
Produkt-Name |
1,2-Diphenoxyethane |
Englischer Name |
1,2-Diphenoxyethane; Ethylene glycol diphenyl ether; 1,1'-[ethane-1,2-diylbis(oxy)]dibenzene; 1,2-Diphenoxy ethane |
Molekulare Formel |
C14H14O2 |
Molecular Weight |
214.2598 |
InChI |
InChI=1/C14H14O2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2 |
CAS Registry Number |
104-66-5 |
EINECS |
203-224-9 |
Molecular Structure |
|
Dichte |
1.08g/cm3 |
Schmelzpunkt |
95-98℃ |
Siedepunkt |
341.6°C at 760 mmHg |
Brechungsindex |
1.556 |
Flammpunkt |
139.4°C |
Dampfdruck |
0.000158mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|