ChemNet > CAS > 104451-99-2 2-Chloro-6-fluoro-3-methylbenzaldehyde
104451-99-2 2-Chloro-6-fluoro-3-methylbenzaldehyde
| Produkt-Name |
2-Chloro-6-fluoro-3-methylbenzaldehyde |
| Englischer Name |
2-Chloro-6-fluoro-3-methylbenzaldehyde; 2-Chloro-6-fluoro-m-tolualdehyde |
| Molekulare Formel |
C8H6ClFO |
| Molecular Weight |
172.584 |
| InChI |
InChI=1/C8H6ClFO/c1-5-2-3-7(10)6(4-11)8(5)9/h2-4H,1H3 |
| CAS Registry Number |
104451-99-2 |
| Molecular Structure |
|
| Dichte |
1.292g/cm3 |
| Schmelzpunkt |
30-33℃ |
| Siedepunkt |
225.1°C at 760 mmHg |
| Brechungsindex |
1.552 |
| Flammpunkt |
89.9°C |
| Dampfdruck |
0.0882mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
