ChemNet > CAS > 10546-65-3 2,6-Dibromo-4-isopropylaniline
10546-65-3 2,6-Dibromo-4-isopropylaniline
Produkt-Name |
2,6-Dibromo-4-isopropylaniline |
Englischer Name |
2,6-Dibromo-4-isopropylaniline; 2,6-Dibromo-4-n-propylaniline; 2,6-dibromo-4-(propan-2-yl)aniline; 2,6-dibromo-4-(1-methylethyl)-Benzenamine |
Molekulare Formel |
C9H11Br2N |
Molecular Weight |
292.9983 |
InChI |
InChI=1/C9H11Br2N/c1-5(2)6-3-7(10)9(12)8(11)4-6/h3-5H,12H2,1-2H3 |
CAS Registry Number |
10546-65-3 |
Molecular Structure |
|
Dichte |
1.682g/cm3 |
Siedepunkt |
310.6°C at 760 mmHg |
Brechungsindex |
1.605 |
Flammpunkt |
141.6°C |
Dampfdruck |
0.000595mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|