106-57-0 Glycine anhydride
Produkt-Name |
Glycine anhydride |
Englischer Name |
Glycine anhydride; 2,5-Diketopiperazine; 2,5-Piperazinedione,(Glycine anhydride); Dioxo Piperazine; Cyclo(-Gly-Gly); 2,5-Piperazinedione; piperazine-2,5-dione; piperazine-2,3-dione |
Molekulare Formel |
C4H6N2O2 |
Molecular Weight |
114.1026 |
InChI |
InChI=1/C4H6N2O2/c7-3-4(8)6-2-1-5-3/h1-2H2,(H,5,7)(H,6,8) |
CAS Registry Number |
106-57-0 |
EINECS |
203-411-5 |
Molecular Structure |
|
Dichte |
1.246g/cm3 |
Schmelzpunkt |
300℃ |
Brechungsindex |
1.467 |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|