ChemNet > CAS > 108124-17-0 2-Methyl-5-phenylfuran-3-carboxylic acid
108124-17-0 2-Methyl-5-phenylfuran-3-carboxylic acid
| Produkt-Name |
2-Methyl-5-phenylfuran-3-carboxylic acid |
| Englischer Name |
2-Methyl-5-phenylfuran-3-carboxylic acid; 2-Methyl-5-phenyl-3-furoic acid; 2-methyl-5-phenylfuran-3-carboxylate |
| Molekulare Formel |
C12H9O3 |
| Molecular Weight |
201.1986 |
| InChI |
InChI=1/C12H10O3/c1-8-10(12(13)14)7-11(15-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14)/p-1 |
| CAS Registry Number |
108124-17-0 |
| Molecular Structure |
|
| Schmelzpunkt |
176-179℃ |
| Siedepunkt |
357.1°C at 760 mmHg |
| Flammpunkt |
169.8°C |
| Dampfdruck |
1.01E-05mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
