ChemNet > CAS > 108847-20-7 Dibenzothiophene-4-boronic acid
108847-20-7 Dibenzothiophene-4-boronic acid
Produkt-Name |
Dibenzothiophene-4-boronic acid |
Englischer Name |
Dibenzothiophene-4-boronic acid; Dibenzo[b,d]thiophen-4-ylboronic acid; 4-Dibenzothienylboronic acid; 4-DIBENZOTHIOPHENEBORONIC ACID |
Molekulare Formel |
C12H9BO2S |
Molecular Weight |
228.0747 |
InChI |
InChI=1/C12H9BO2S/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h1-7,14-15H |
CAS Registry Number |
108847-20-7 |
Molecular Structure |
|
Dichte |
1.38g/cm3 |
Schmelzpunkt |
327-330℃ |
Siedepunkt |
480.2°C at 760 mmHg |
Brechungsindex |
1.738 |
Flammpunkt |
244.2°C |
Dampfdruck |
4.97E-10mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S22:;
S24/25:;
|
|