ChemNet > CAS > 110-14-5 Succinamide
110-14-5 Succinamide
| Produkt-Name |
Succinamide |
| Englischer Name |
Succinamide; Butanediamide; Succinic diamide; Butanedioic acid diamide |
| Molekulare Formel |
C4H8N2O2 |
| Molecular Weight |
116.1185 |
| InChI |
InChI=1/C4H8N2O2/c5-3(7)1-2-4(6)8/h1-2H2,(H2,5,7)(H2,6,8) |
| CAS Registry Number |
110-14-5 |
| EINECS |
203-739-9 |
| Molecular Structure |
|
| Dichte |
1.207g/cm3 |
| Schmelzpunkt |
260-265℃ |
| Siedepunkt |
494°C at 760 mmHg |
| Brechungsindex |
1.488 |
| Flammpunkt |
252.6°C |
| Dampfdruck |
6.7E-10mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
