ChemNet > CAS > 111821-49-9 4-Borono-D-phenylalanin
111821-49-9 4-Borono-D-phenylalanin
| Produkt-Name |
4-Borono-D-phenylalanin |
| Synonyme |
4-(Dihydroxyboranyl)-D-phenylalanin |
| Englischer Name |
4-Borono-D-phenylalanine;4-(dihydroxyboranyl)-D-phenylalanine |
| Molekulare Formel |
C9H12BNO4 |
| Molecular Weight |
209.0069 |
| InChI |
InChI=1/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m1/s1 |
| CAS Registry Number |
111821-49-9 |
| Molecular Structure |
|
| Dichte |
1.34g/cm3 |
| Siedepunkt |
449.3°C at 760 mmHg |
| Brechungsindex |
1.59 |
| Flammpunkt |
225.5°C |
| Dampfdruck |
7.39E-09mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
