ChemNet > CAS > 112055-36-4 Ethyl 2-(4-chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate
112055-36-4 Ethyl 2-(4-chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate
| Produkt-Name |
Ethyl 2-(4-chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate |
| Englischer Name |
Ethyl 2-(4-chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate; Ethyl 1-(4-chlorophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylate |
| Molekulare Formel |
C6H4FI |
| Molecular Weight |
221.9988 |
| InChI |
InChI=1/C6H4FI/c7-5-2-1-3-6(8)4-5/h1-4H |
| CAS Registry Number |
112055-36-4 |
| EINECS |
214-339-9 |
| Molecular Structure |
|
| Dichte |
1.918g/cm3 |
| Schmelzpunkt |
52-54℃ |
| Siedepunkt |
183°C at 760 mmHg |
| Brechungsindex |
1.591 |
| Flammpunkt |
67.2°C |
| Dampfdruck |
1.07mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
