ChemNet > CAS > 112193-41-6 5-Bromopyridin-3-carbohydrazid
112193-41-6 5-Bromopyridin-3-carbohydrazid
| Produkt-Name |
5-Bromopyridin-3-carbohydrazid |
| Englischer Name |
5-bromopyridine-3-carbohydrazide; |
| Molekulare Formel |
C6H6BrN3O |
| Molecular Weight |
216.0353 |
| InChI |
InChI=1/C6H6BrN3O/c7-5-1-4(2-9-3-5)6(11)10-8/h1-3H,8H2,(H,10,11) |
| CAS Registry Number |
112193-41-6 |
| Molecular Structure |
|
| Dichte |
1.709g/cm3 |
| Schmelzpunkt |
204℃ |
| Brechungsindex |
1.623 |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
