ChemNet > CAS > 1123-25-7 1-Methyl-1-cyclohexanecarboxylic acid
1123-25-7 1-Methyl-1-cyclohexanecarboxylic acid
Produkt-Name |
1-Methyl-1-cyclohexanecarboxylic acid |
Englischer Name |
1-Methyl-1-cyclohexanecarboxylic acid; 1-Methylcyclohexanecarboxylic acid; 1-Methyl-1-cyclohexancarboxylic acid; 1-methylcyclohexanecarboxylate |
Molekulare Formel |
C8H13O2 |
Molecular Weight |
141.1882 |
InChI |
InChI=1/C8H14O2/c1-8(7(9)10)5-3-2-4-6-8/h2-6H2,1H3,(H,9,10)/p-1 |
CAS Registry Number |
1123-25-7 |
EINECS |
214-371-3 |
Molecular Structure |
|
Schmelzpunkt |
35-38℃ |
Siedepunkt |
234°C at 760 mmHg |
Flammpunkt |
114°C |
Dampfdruck |
0.0188mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|